C26H27F3N6O3 — CID 169193702
(1R,2S,5S)-N-[cyano(phthalazin-1-yl)methyl]-3-[(2S)-3-cyclopropyl-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 169193702) has the molecular formula C26H27F3N6O3 and a molecular weight of 528.54 g/mol. Its IUPAC name is (1R,2S,5S)-N-[cyano(phthalazin-1-yl)methyl]-3-[(2S)-3-cyclopropyl-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,2S,5S)-N-[cyano(phthalazin-1-yl)methyl]-3-[(2S)-3-cyclopropyl-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 169193702 |
| Molecular Formula | C26H27F3N6O3 |
| Molecular Weight | 528.54 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | (1R,2S,5S)-N-[cyano(phthalazin-1-yl)methyl]-3-[(2S)-3-cyclopropyl-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | CC1(C)[C@@H]2[C@@H](C(=O)NC(C#N)c3nncc4ccccc34)N(C(=O)[C@H](CC3CC3)NC(=O)C(F)(F)F)C[C@@H]21 |
| InChI | InChI=1S/C26H27F3N6O3/c1-25(2)16-12-35(23(37)17(9-13-7-8-13)33-24(38)26(27,28)29)21(19(16)25)22(36)32-18(10-30)20-15-6-4-3-5-14(15)11-31-34-20/h3-6,11,13,16-19,21H,7-9,12H2,1-2H3,(H,32,36)(H,33,38)/t16-,17-,18?,19-,21-/m0/s1 |
| InChIKey | ZMMRZZSQKPBXDN-BBYRXIDASA-N |
| XLogP | 2.64 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.54 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |