C25H27F3N6O3 — CID 170166373
(3S,3aS,6aR)-N-[cyano(phthalazin-1-yl)methyl]-2-[3-methyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide (PubChem CID 170166373) has the molecular formula C25H27F3N6O3 and a molecular weight of 516.52 g/mol. Its IUPAC name is (3S,3aS,6aR)-N-[cyano(phthalazin-1-yl)methyl]-2-[3-methyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | (3S,3aS,6aR)-N-[cyano(phthalazin-1-yl)methyl]-2-[3-methyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 170166373 |
| Molecular Formula | C25H27F3N6O3 |
| Molecular Weight | 516.52 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | (3S,3aS,6aR)-N-[cyano(phthalazin-1-yl)methyl]-2-[3-methyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
| SMILES | CC(C)C(NC(=O)C(F)(F)F)C(=O)N1C[C@@H]2CCC[C@@H]2[C@H]1C(=O)NC(C#N)c1nncc2ccccc12 |
| InChI | InChI=1S/C25H27F3N6O3/c1-13(2)19(32-24(37)25(26,27)28)23(36)34-12-15-7-5-9-17(15)21(34)22(35)31-18(10-29)20-16-8-4-3-6-14(16)11-30-33-20/h3-4,6,8,11,13,15,17-19,21H,5,7,9,12H2,1-2H3,(H,31,35)(H,32,37)/t15-,17-,18?,19?,21-/m0/s1 |
| InChIKey | QBNVRVVWNIOQNV-SINSCKLOSA-N |
| XLogP | 2.64 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.52 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |