C27H31F3N6O4 — CID 169194057
(1R,2S,5S)-N-[cyano(phthalazin-1-yl)methyl]-3-[3-ethoxy-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 169194057) has the molecular formula C27H31F3N6O4 and a molecular weight of 560.58 g/mol. Its IUPAC name is (1R,2S,5S)-N-[cyano(phthalazin-1-yl)methyl]-3-[3-ethoxy-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,2S,5S)-N-[cyano(phthalazin-1-yl)methyl]-3-[3-ethoxy-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 169194057 |
| Molecular Formula | C27H31F3N6O4 |
| Molecular Weight | 560.58 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | (1R,2S,5S)-N-[cyano(phthalazin-1-yl)methyl]-3-[3-ethoxy-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | CCOC(C)(C)C(NC(=O)C(F)(F)F)C(=O)N1C[C@H]2[C@@H]([C@H]1C(=O)NC(C#N)c1nncc3ccccc13)C2(C)C |
| InChI | InChI=1S/C27H31F3N6O4/c1-6-40-26(4,5)21(34-24(39)27(28,29)30)23(38)36-13-16-18(25(16,2)3)20(36)22(37)33-17(11-31)19-15-10-8-7-9-14(15)12-32-35-19/h7-10,12,16-18,20-21H,6,13H2,1-5H3,(H,33,37)(H,34,39)/t16-,17?,18-,20-,21?/m0/s1 |
| InChIKey | CGYODMCWYQAFAM-DBLQMQDVSA-N |
| XLogP | 2.66 |
| TPSA | 137.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.58 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |