C26H32F2N6O4 — CID 170167421
(1R,2S,5S)-N-(2-amino-2-oxo-1-phthalazin-1-ylethyl)-3-[2-(2,2-difluoropropanoylamino)-3-methylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 170167421) has the molecular formula C26H32F2N6O4 and a molecular weight of 530.58 g/mol. Its IUPAC name is (1R,2S,5S)-N-(2-amino-2-oxo-1-phthalazin-1-ylethyl)-3-[2-(2,2-difluoropropanoylamino)-3-methylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,2S,5S)-N-(2-amino-2-oxo-1-phthalazin-1-ylethyl)-3-[2-(2,2-difluoropropanoylamino)-3-methylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 170167421 |
| Molecular Formula | C26H32F2N6O4 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | (1R,2S,5S)-N-(2-amino-2-oxo-1-phthalazin-1-ylethyl)-3-[2-(2,2-difluoropropanoylamino)-3-methylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | CC(C)C(NC(=O)C(C)(F)F)C(=O)N1C[C@H]2[C@@H]([C@H]1C(=O)NC(C(N)=O)c1nncc3ccccc13)C2(C)C |
| InChI | InChI=1S/C26H32F2N6O4/c1-12(2)17(32-24(38)26(5,27)28)23(37)34-11-15-16(25(15,3)4)20(34)22(36)31-19(21(29)35)18-14-9-7-6-8-13(14)10-30-33-18/h6-10,12,15-17,19-20H,11H2,1-5H3,(H2,29,35)(H,31,36)(H,32,38)/t15-,16-,17?,19?,20-/m0/s1 |
| InChIKey | QIHSDVCSRVBSDZ-FKFKMFNGSA-N |
| XLogP | 1.55 |
| TPSA | 147.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |