C27H31F3N6O5 — CID 170167837
(1R,2S,5S)-N-(2-amino-2-oxo-1-phthalazin-1-ylethyl)-6,6-dimethyl-3-[3-(oxolan-3-yl)-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 170167837) has the molecular formula C27H31F3N6O5 and a molecular weight of 576.58 g/mol. Its IUPAC name is (1R,2S,5S)-N-(2-amino-2-oxo-1-phthalazin-1-ylethyl)-6,6-dimethyl-3-[3-(oxolan-3-yl)-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,2S,5S)-N-(2-amino-2-oxo-1-phthalazin-1-ylethyl)-6,6-dimethyl-3-[3-(oxolan-3-yl)-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 170167837 |
| Molecular Formula | C27H31F3N6O5 |
| Molecular Weight | 576.58 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | (1R,2S,5S)-N-(2-amino-2-oxo-1-phthalazin-1-ylethyl)-6,6-dimethyl-3-[3-(oxolan-3-yl)-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | CC1(C)[C@@H]2[C@@H](C(=O)NC(C(N)=O)c3nncc4ccccc34)N(C(=O)C(CC3CCOC3)NC(=O)C(F)(F)F)C[C@@H]21 |
| InChI | InChI=1S/C27H31F3N6O5/c1-26(2)16-11-36(24(39)17(9-13-7-8-41-12-13)33-25(40)27(28,29)30)21(18(16)26)23(38)34-20(22(31)37)19-15-6-4-3-5-14(15)10-32-35-19/h3-6,10,13,16-18,20-21H,7-9,11-12H2,1-2H3,(H2,31,37)(H,33,40)(H,34,38)/t13?,16-,17?,18-,20?,21-/m0/s1 |
| InChIKey | IHVRYTUVSXZNGP-DCNFHOMMSA-N |
| XLogP | 1.23 |
| TPSA | 156.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.58 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |