C14H14BrFN2O2 — CID 170165701
(3R,4S)-4-(4-bromoindol-1-yl)-3-fluoropiperidine-1-carboxylic acid (PubChem CID 170165701) has the molecular formula C14H14BrFN2O2 and a molecular weight of 341.18 g/mol. Its IUPAC name is (3R,4S)-4-(4-bromoindol-1-yl)-3-fluoropiperidine-1-carboxylic acid.
| Compound Name | (3R,4S)-4-(4-bromoindol-1-yl)-3-fluoropiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 170165701 |
| Molecular Formula | C14H14BrFN2O2 |
| Molecular Weight | 341.18 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | (3R,4S)-4-(4-bromoindol-1-yl)-3-fluoropiperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CC[C@H](n2ccc3c(Br)cccc32)[C@H](F)C1 |
| InChI | InChI=1S/C14H14BrFN2O2/c15-10-2-1-3-12-9(10)4-7-18(12)13-5-6-17(14(19)20)8-11(13)16/h1-4,7,11,13H,5-6,8H2,(H,19,20)/t11-,13+/m1/s1 |
| InChIKey | XGDZMPYZLDLUMF-YPMHNXCESA-N |
| XLogP | 3.67 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.18 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |