C13H18ClNO3 — CID 170166125
methyl 4-(benzylamino)oxolane-2-carboxylate;hydrochloride (PubChem CID 170166125) has the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. Its IUPAC name is methyl 4-(benzylamino)oxolane-2-carboxylate;hydrochloride.
| Compound Name | methyl 4-(benzylamino)oxolane-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 170166125 |
| Molecular Formula | C13H18ClNO3 |
| Molecular Weight | 271.74 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | methyl 4-(benzylamino)oxolane-2-carboxylate;hydrochloride |
| SMILES | COC(=O)C1CC(NCc2ccccc2)CO1.Cl |
| InChI | InChI=1S/C13H17NO3.ClH/c1-16-13(15)12-7-11(9-17-12)14-8-10-5-3-2-4-6-10;/h2-6,11-12,14H,7-9H2,1H3;1H |
| InChIKey | NMSBCMLEKHZOFH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.74 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |