C16H10ClF3N2 — CID 17016624
6-chloro-N-[2-(trifluoromethyl)phenyl]quinolin-4-amine (PubChem CID 17016624) has the molecular formula C16H10ClF3N2 and a molecular weight of 322.72 g/mol. Its IUPAC name is 6-chloro-N-[2-(trifluoromethyl)phenyl]quinolin-4-amine.
| Compound Name | 6-chloro-N-[2-(trifluoromethyl)phenyl]quinolin-4-amine |
|---|---|
| PubChem CID | 17016624 |
| Molecular Formula | C16H10ClF3N2 |
| Molecular Weight | 322.72 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 6-chloro-N-[2-(trifluoromethyl)phenyl]quinolin-4-amine |
| SMILES | FC(F)(F)c1ccccc1Nc1ccnc2ccc(Cl)cc12 |
| InChI | InChI=1S/C16H10ClF3N2/c17-10-5-6-13-11(9-10)14(7-8-21-13)22-15-4-2-1-3-12(15)16(18,19)20/h1-9H,(H,21,22) |
| InChIKey | HAPIJSXUHRABCW-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.72 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |