C16H12Cl2N2S — CID 123150888
N-(2,4-dichlorophenyl)-6-methylsulfanylquinolin-4-amine (PubChem CID 123150888) has the molecular formula C16H12Cl2N2S and a molecular weight of 335.26 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-6-methylsulfanylquinolin-4-amine.
| Compound Name | N-(2,4-dichlorophenyl)-6-methylsulfanylquinolin-4-amine |
|---|---|
| PubChem CID | 123150888 |
| Molecular Formula | C16H12Cl2N2S |
| Molecular Weight | 335.26 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | N-(2,4-dichlorophenyl)-6-methylsulfanylquinolin-4-amine |
| SMILES | CSc1ccc2nccc(Nc3ccc(Cl)cc3Cl)c2c1 |
| InChI | InChI=1S/C16H12Cl2N2S/c1-21-11-3-5-14-12(9-11)15(6-7-19-14)20-16-4-2-10(17)8-13(16)18/h2-9H,1H3,(H,19,20) |
| InChIKey | HLFCCGZBZPCODB-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.26 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |