About 1-[bis(1-hydroxyethyl)amino]ethanol;2-[methyl(tetradecanoyl)amino]acetic acid
1-[bis(1-hydroxyethyl)amino]ethanol;2-[methyl(tetradecanoyl)amino]acetic acid (PubChem CID 170168150) has the molecular formula C23H48N2O6
and a molecular weight of 448.65 g/mol. Its IUPAC name is 1-[bis(1-hydroxyethyl)amino]ethanol;2-[methyl(tetradecanoyl)amino]acetic acid.
Molecular Properties
| Compound Name | 1-[bis(1-hydroxyethyl)amino]ethanol;2-[methyl(tetradecanoyl)amino]acetic acid |
| PubChem CID | 170168150 |
| Molecular Formula | C23H48N2O6 |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.35 |
| IUPAC Name | 1-[bis(1-hydroxyethyl)amino]ethanol;2-[methyl(tetradecanoyl)amino]acetic acid |
| SMILES | CC(O)N(C(C)O)C(C)O.CCCCCCCCCCCCCC(=O)N(C)CC(=O)O |
| InChI | InChI=1S/C17H33NO3.C6H15NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-16(19)18(2)15-17(20)21;1-4(8)7(5(2)9)6(3)10/h3-15H2,1-2H3,(H,20,21);4-6,8-10H,1-3H3 |
| InChIKey | ZTHHHFUJQPQOHM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 121.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[bis(1-hydroxyethyl)amino]ethanol;2-[methyl(tetradecanoyl)amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[bis(1-hydroxyethyl)amino]ethanol;2-[methyl(tetradecanoyl)amino]acetic acid?
The IUPAC name of 1-[bis(1-hydroxyethyl)amino]ethanol;2-[methyl(tetradecanoyl)amino]acetic acid (CID 170168150) is 1-[bis(1-hydroxyethyl)amino]ethanol;2-[methyl(tetradecanoyl)amino]acetic acid.
What is the SMILES notation for 1-[bis(1-hydroxyethyl)amino]ethanol;2-[methyl(tetradecanoyl)amino]acetic acid?
The canonical SMILES for 1-[bis(1-hydroxyethyl)amino]ethanol;2-[methyl(tetradecanoyl)amino]acetic acid is CC(O)N(C(C)O)C(C)O.CCCCCCCCCCCCCC(=O)N(C)CC(=O)O.
What is the InChIKey of 1-[bis(1-hydroxyethyl)amino]ethanol;2-[methyl(tetradecanoyl)amino]acetic acid?
The InChIKey is ZTHHHFUJQPQOHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33NO3.C6H15NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-16(19)18(2)15-17(20)21;1-4(8)7(5(2)9)6(3)10/h3-15H2,1-2H3,(H,20,21);4-6,8-10H,1-3H3.
What are the key properties of 1-[bis(1-hydroxyethyl)amino]ethanol;2-[methyl(tetradecanoyl)amino]acetic acid?
1-[bis(1-hydroxyethyl)amino]ethanol;2-[methyl(tetradecanoyl)amino]acetic acid has a molecular weight of 448.65 g/mol, XLogP of 3.53, 17 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[bis(1-hydroxyethyl)amino]ethanol;2-[methyl(tetradecanoyl)amino]acetic acid is sourced from PubChem (CID 170168150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).