C34H32F2N3O6PS — CID 170168171
[difluoro-[2-[[(1R,3S,5R,7S,10S)-8-oxo-10-[(4-phenylphenyl)carbamoyl]-9-azatricyclo[7.3.0.03,5]dodecan-7-yl]carbamoyl]-1-benzothiophen-5-yl]methyl]phosphonic acid (PubChem CID 170168171) has the molecular formula C34H32F2N3O6PS and a molecular weight of 679.68 g/mol. Its IUPAC name is [difluoro-[2-[[(1R,3S,5R,7S,10S)-8-oxo-10-[(4-phenylphenyl)carbamoyl]-9-azatricyclo[7.3.0.03,5]dodecan-7-yl]carbamoyl]-1-benzothiophen-5-yl]methyl]phosphonic acid.
| Compound Name | [difluoro-[2-[[(1R,3S,5R,7S,10S)-8-oxo-10-[(4-phenylphenyl)carbamoyl]-9-azatricyclo[7.3.0.03,5]dodecan-7-yl]carbamoyl]-1-benzothiophen-5-yl]methyl]phosphonic acid |
|---|---|
| PubChem CID | 170168171 |
| Molecular Formula | C34H32F2N3O6PS |
| Molecular Weight | 679.68 g/mol |
| Exact Mass | 679.17 |
| IUPAC Name | [difluoro-[2-[[(1R,3S,5R,7S,10S)-8-oxo-10-[(4-phenylphenyl)carbamoyl]-9-azatricyclo[7.3.0.03,5]dodecan-7-yl]carbamoyl]-1-benzothiophen-5-yl]methyl]phosphonic acid |
| SMILES | O=C(N[C@H]1C[C@H]2C[C@H]2C[C@H]2CC[C@@H](C(=O)Nc3ccc(-c4ccccc4)cc3)N2C1=O)c1cc2cc(C(F)(F)P(=O)(O)O)ccc2s1 |
| InChI | InChI=1S/C34H32F2N3O6PS/c35-34(36,46(43,44)45)24-8-13-29-23(15-24)18-30(47-29)32(41)38-27-17-22-14-21(22)16-26-11-12-28(39(26)33(27)42)31(40)37-25-9-6-20(7-10-25)19-4-2-1-3-5-19/h1-10,13,15,18,21-22,26-28H,11-12,14,16-17H2,(H,37,40)(H,38,41)(H2,43,44,45)/t21-,22+,26+,27-,28-/m0/s1 |
| InChIKey | FDZIQPUKYNIGSA-XCTSUQSWSA-N |
| XLogP | 6.32 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.68 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|