C30H31F2N4O6PS — CID 176807530
[difluoro-[2-[[(1R,3S,5R,7S,10S)-8-oxo-10-(1-pyridin-3-ylazetidine-3-carbonyl)-9-azatricyclo[7.3.0.03,5]dodecan-7-yl]carbamoyl]-1-benzothiophen-5-yl]methyl]phosphonic acid (PubChem CID 176807530) has the molecular formula C30H31F2N4O6PS and a molecular weight of 644.64 g/mol. Its IUPAC name is [difluoro-[2-[[(1R,3S,5R,7S,10S)-8-oxo-10-(1-pyridin-3-ylazetidine-3-carbonyl)-9-azatricyclo[7.3.0.03,5]dodecan-7-yl]carbamoyl]-1-benzothiophen-5-yl]methyl]phosphonic acid.
| Compound Name | [difluoro-[2-[[(1R,3S,5R,7S,10S)-8-oxo-10-(1-pyridin-3-ylazetidine-3-carbonyl)-9-azatricyclo[7.3.0.03,5]dodecan-7-yl]carbamoyl]-1-benzothiophen-5-yl]methyl]phosphonic acid |
|---|---|
| PubChem CID | 176807530 |
| Molecular Formula | C30H31F2N4O6PS |
| Molecular Weight | 644.64 g/mol |
| Exact Mass | 644.17 |
| IUPAC Name | [difluoro-[2-[[(1R,3S,5R,7S,10S)-8-oxo-10-(1-pyridin-3-ylazetidine-3-carbonyl)-9-azatricyclo[7.3.0.03,5]dodecan-7-yl]carbamoyl]-1-benzothiophen-5-yl]methyl]phosphonic acid |
| SMILES | O=C(N[C@H]1C[C@H]2C[C@H]2C[C@H]2CC[C@@H](C(=O)C3CN(c4cccnc4)C3)N2C1=O)c1cc2cc(C(F)(F)P(=O)(O)O)ccc2s1 |
| InChI | InChI=1S/C30H31F2N4O6PS/c31-30(32,43(40,41)42)20-3-6-25-18(9-20)12-26(44-25)28(38)34-23-11-17-8-16(17)10-21-4-5-24(36(21)29(23)39)27(37)19-14-35(15-19)22-2-1-7-33-13-22/h1-3,6-7,9,12-13,16-17,19,21,23-24H,4-5,8,10-11,14-15H2,(H,34,38)(H2,40,41,42)/t16-,17+,21+,23-,24-/m0/s1 |
| InChIKey | MDGPXPYIAWFEML-LZVLNPEASA-N |
| XLogP | 4.12 |
| TPSA | 140.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.64 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|