C21H21F2N3O — CID 170171586
1-fluoro-3-(1-fluorocyclohexyl)-1-(1H-indol-3-yl)-3-phenylurea (PubChem CID 170171586) has the molecular formula C21H21F2N3O and a molecular weight of 369.42 g/mol. Its IUPAC name is 1-fluoro-3-(1-fluorocyclohexyl)-1-(1H-indol-3-yl)-3-phenylurea.
| Compound Name | 1-fluoro-3-(1-fluorocyclohexyl)-1-(1H-indol-3-yl)-3-phenylurea |
|---|---|
| PubChem CID | 170171586 |
| Molecular Formula | C21H21F2N3O |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 1-fluoro-3-(1-fluorocyclohexyl)-1-(1H-indol-3-yl)-3-phenylurea |
| SMILES | O=C(N(F)c1c[nH]c2ccccc12)N(c1ccccc1)C1(F)CCCCC1 |
| InChI | InChI=1S/C21H21F2N3O/c22-21(13-7-2-8-14-21)25(16-9-3-1-4-10-16)20(27)26(23)19-15-24-18-12-6-5-11-17(18)19/h1,3-6,9-12,15,24H,2,7-8,13-14H2 |
| InChIKey | ZDRKCCBGMGDUNR-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|