C20H23F3N8O2S — CID 170172078
4-[1-[3-amino-5-(trifluoromethyl)phenyl]ethylamino]-5-pyrrolidin-1-yl-2-(sulfamoylamino)pyrido[3,4-d]pyrimidine (PubChem CID 170172078) has the molecular formula C20H23F3N8O2S and a molecular weight of 496.52 g/mol. Its IUPAC name is 4-[1-[3-amino-5-(trifluoromethyl)phenyl]ethylamino]-5-pyrrolidin-1-yl-2-(sulfamoylamino)pyrido[3,4-d]pyrimidine.
| Compound Name | 4-[1-[3-amino-5-(trifluoromethyl)phenyl]ethylamino]-5-pyrrolidin-1-yl-2-(sulfamoylamino)pyrido[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 170172078 |
| Molecular Formula | C20H23F3N8O2S |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | 4-[1-[3-amino-5-(trifluoromethyl)phenyl]ethylamino]-5-pyrrolidin-1-yl-2-(sulfamoylamino)pyrido[3,4-d]pyrimidine |
| SMILES | CC(Nc1nc(NS(N)(=O)=O)nc2cncc(N3CCCC3)c12)c1cc(N)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H23F3N8O2S/c1-11(12-6-13(20(21,22)23)8-14(24)7-12)27-18-17-15(28-19(29-18)30-34(25,32)33)9-26-10-16(17)31-4-2-3-5-31/h6-11H,2-5,24H2,1H3,(H2,25,32,33)(H2,27,28,29,30) |
| InChIKey | XKSKIZQZWAYQDG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 152.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|