C33H36N4O2 — CID 170176677
N-methyl-4-[5-(2-methyl-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-N-(oxolan-3-ylmethyl)benzamide (PubChem CID 170176677) has the molecular formula C33H36N4O2 and a molecular weight of 520.68 g/mol. Its IUPAC name is N-methyl-4-[5-(2-methyl-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-N-(oxolan-3-ylmethyl)benzamide.
| Compound Name | N-methyl-4-[5-(2-methyl-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-N-(oxolan-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 170176677 |
| Molecular Formula | C33H36N4O2 |
| Molecular Weight | 520.68 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | N-methyl-4-[5-(2-methyl-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-N-(oxolan-3-ylmethyl)benzamide |
| SMILES | CN1Cc2cc(-c3cnc4[nH]cc(-c5ccc(C(=O)N(C)CC6CCOC6)cc5)c4c3)cc3c2C(CCC3)C1 |
| InChI | InChI=1S/C33H36N4O2/c1-36-18-25-5-3-4-24-12-26(13-28(19-36)31(24)25)27-14-29-30(16-35-32(29)34-15-27)22-6-8-23(9-7-22)33(38)37(2)17-21-10-11-39-20-21/h6-9,12-16,21,25H,3-5,10-11,17-20H2,1-2H3,(H,34,35) |
| InChIKey | ZGIODKQKJZMQOD-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.68 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |