C17H12N2O — CID 170177747
N-phenyl-[1]benzofuro[2,3-b]pyridin-7-amine (PubChem CID 170177747) has the molecular formula C17H12N2O and a molecular weight of 260.30 g/mol. Its IUPAC name is N-phenyl-[1]benzofuro[2,3-b]pyridin-7-amine.
| Compound Name | N-phenyl-[1]benzofuro[2,3-b]pyridin-7-amine |
|---|---|
| PubChem CID | 170177747 |
| Molecular Formula | C17H12N2O |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | N-phenyl-[1]benzofuro[2,3-b]pyridin-7-amine |
| SMILES | c1ccc(Nc2ccc3c(c2)oc2ncccc23)cc1 |
| InChI | InChI=1S/C17H12N2O/c1-2-5-12(6-3-1)19-13-8-9-14-15-7-4-10-18-17(15)20-16(14)11-13/h1-11,19H |
| InChIKey | WYQIRWZFDXLLAI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |