C17H10ClNO — CID 155173552
7-(3-chlorophenyl)-[1]benzofuro[2,3-b]pyridine (PubChem CID 155173552) has the molecular formula C17H10ClNO and a molecular weight of 279.73 g/mol. Its IUPAC name is 7-(3-chlorophenyl)-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 7-(3-chlorophenyl)-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 155173552 |
| Molecular Formula | C17H10ClNO |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 7-(3-chlorophenyl)-[1]benzofuro[2,3-b]pyridine |
| SMILES | Clc1cccc(-c2ccc3c(c2)oc2ncccc23)c1 |
| InChI | InChI=1S/C17H10ClNO/c18-13-4-1-3-11(9-13)12-6-7-14-15-5-2-8-19-17(15)20-16(14)10-12/h1-10H |
| InChIKey | CJABQPBISHKMKX-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |