C26H15ClN4O — CID 171832576
2-(4-chloro-2-pyridinyl)-4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazine (PubChem CID 171832576) has the molecular formula C26H15ClN4O and a molecular weight of 434.89 g/mol. Its IUPAC name is 2-(4-chloro-2-pyridinyl)-4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazine.
| Compound Name | 2-(4-chloro-2-pyridinyl)-4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 171832576 |
| Molecular Formula | C26H15ClN4O |
| Molecular Weight | 434.89 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 2-(4-chloro-2-pyridinyl)-4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazine |
| SMILES | Clc1ccnc(-c2nc(-c3ccccc3)nc(-c3ccc4c(c3)oc3ccccc34)n2)c1 |
| InChI | InChI=1S/C26H15ClN4O/c27-18-12-13-28-21(15-18)26-30-24(16-6-2-1-3-7-16)29-25(31-26)17-10-11-20-19-8-4-5-9-22(19)32-23(20)14-17/h1-15H |
| InChIKey | MDMAPAGHMKJDSU-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.89 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |