C27H36FN5O4S — CID 170178616
2-(6-azaspiro[2.5]octan-6-yl)-N-[5-(fluoromethoxy)-6-[(2S)-2-methylmorpholin-4-yl]-2-pyridinyl]-4-(2-hydroxyethylamino)sulfanylbenzamide (PubChem CID 170178616) has the molecular formula C27H36FN5O4S and a molecular weight of 545.68 g/mol. Its IUPAC name is 2-(6-azaspiro[2.5]octan-6-yl)-N-[5-(fluoromethoxy)-6-[(2S)-2-methylmorpholin-4-yl]-2-pyridinyl]-4-(2-hydroxyethylamino)sulfanylbenzamide.
| Compound Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-[5-(fluoromethoxy)-6-[(2S)-2-methylmorpholin-4-yl]-2-pyridinyl]-4-(2-hydroxyethylamino)sulfanylbenzamide |
|---|---|
| PubChem CID | 170178616 |
| Molecular Formula | C27H36FN5O4S |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.25 |
| IUPAC Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-[5-(fluoromethoxy)-6-[(2S)-2-methylmorpholin-4-yl]-2-pyridinyl]-4-(2-hydroxyethylamino)sulfanylbenzamide |
| SMILES | C[C@H]1CN(c2nc(NC(=O)c3ccc(SNCCO)cc3N3CCC4(CC3)CC4)ccc2OCF)CCO1 |
| InChI | InChI=1S/C27H36FN5O4S/c1-19-17-33(13-15-36-19)25-23(37-18-28)4-5-24(30-25)31-26(35)21-3-2-20(38-29-10-14-34)16-22(21)32-11-8-27(6-7-27)9-12-32/h2-5,16,19,29,34H,6-15,17-18H2,1H3,(H,30,31,35)/t19-/m0/s1 |
| InChIKey | YOIBEPKIXFHBND-IBGZPJMESA-N |
| XLogP | 3.83 |
| TPSA | 99.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|