C25H26O2 — CID 170179380
methyl 2-[4-[(2R)-1,4-diphenylbutan-2-yl]phenyl]acetate (PubChem CID 170179380) has the molecular formula C25H26O2 and a molecular weight of 358.48 g/mol. Its IUPAC name is methyl 2-[4-[(2R)-1,4-diphenylbutan-2-yl]phenyl]acetate.
| Compound Name | methyl 2-[4-[(2R)-1,4-diphenylbutan-2-yl]phenyl]acetate |
|---|---|
| PubChem CID | 170179380 |
| Molecular Formula | C25H26O2 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | methyl 2-[4-[(2R)-1,4-diphenylbutan-2-yl]phenyl]acetate |
| SMILES | COC(=O)Cc1ccc([C@H](CCc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C25H26O2/c1-27-25(26)19-22-13-15-23(16-14-22)24(18-21-10-6-3-7-11-21)17-12-20-8-4-2-5-9-20/h2-11,13-16,24H,12,17-19H2,1H3/t24-/m1/s1 |
| InChIKey | UFCQGCUKXUGRGJ-XMMPIXPASA-N |
| XLogP | 5.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |