C24H29FN4O2 — CID 170180091
N-[[2-fluoro-4-[4-(4-methylpiperidin-1-yl)anilino]phenyl]methyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 170180091) has the molecular formula C24H29FN4O2 and a molecular weight of 424.52 g/mol. Its IUPAC name is N-[[2-fluoro-4-[4-(4-methylpiperidin-1-yl)anilino]phenyl]methyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[[2-fluoro-4-[4-(4-methylpiperidin-1-yl)anilino]phenyl]methyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 170180091 |
| Molecular Formula | C24H29FN4O2 |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | N-[[2-fluoro-4-[4-(4-methylpiperidin-1-yl)anilino]phenyl]methyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CC1CCN(c2ccc(Nc3ccc(CNC(=O)C4CNC(=O)C4)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C24H29FN4O2/c1-16-8-10-29(11-9-16)21-6-4-19(5-7-21)28-20-3-2-17(22(25)13-20)14-27-24(31)18-12-23(30)26-15-18/h2-7,13,16,18,28H,8-12,14-15H2,1H3,(H,26,30)(H,27,31) |
| InChIKey | RPAHKTFLBIQUGW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|