C23H26N8O — CID 170187388
2-[(Z)-2-[1H-benzimidazol-4-yl(methyl)amino]-1-(methylideneamino)ethenyl]-N-ethyl-6-[(Z)-1-(methyldiazenyl)prop-1-enyl]pyridine-4-carboxamide (PubChem CID 170187388) has the molecular formula C23H26N8O and a molecular weight of 430.52 g/mol. Its IUPAC name is 2-[(Z)-2-[1H-benzimidazol-4-yl(methyl)amino]-1-(methylideneamino)ethenyl]-N-ethyl-6-[(Z)-1-(methyldiazenyl)prop-1-enyl]pyridine-4-carboxamide.
| Compound Name | 2-[(Z)-2-[1H-benzimidazol-4-yl(methyl)amino]-1-(methylideneamino)ethenyl]-N-ethyl-6-[(Z)-1-(methyldiazenyl)prop-1-enyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 170187388 |
| Molecular Formula | C23H26N8O |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | 2-[(Z)-2-[1H-benzimidazol-4-yl(methyl)amino]-1-(methylideneamino)ethenyl]-N-ethyl-6-[(Z)-1-(methyldiazenyl)prop-1-enyl]pyridine-4-carboxamide |
| SMILES | C=N/C(=C\N(C)c1cccc2[nH]cnc12)c1cc(C(=O)NCC)cc(C(=C/C)/N=N/C)n1 |
| InChI | InChI=1S/C23H26N8O/c1-6-16(30-25-4)18-11-15(23(32)26-7-2)12-19(29-18)20(24-3)13-31(5)21-10-8-9-17-22(21)28-14-27-17/h6,8-14H,3,7H2,1-2,4-5H3,(H,26,32)(H,27,28)/b16-6-,20-13-,30-25+ |
| InChIKey | XLGAPFUSBOFEOS-GWLABIBVSA-N |
| XLogP | 4.29 |
| TPSA | 110.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|