About ethane;3-[ethenyl-[(E)-ethylideneamino]amino]-N-ethylbenzamide
ethane;3-[ethenyl-[(E)-ethylideneamino]amino]-N-ethylbenzamide (PubChem CID 142945288) has the molecular formula C15H23N3O
and a molecular weight of 261.37 g/mol. Its IUPAC name is ethane;3-[ethenyl-[(E)-ethylideneamino]amino]-N-ethylbenzamide.
Molecular Properties
| Compound Name | ethane;3-[ethenyl-[(E)-ethylideneamino]amino]-N-ethylbenzamide |
| PubChem CID | 142945288 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | ethane;3-[ethenyl-[(E)-ethylideneamino]amino]-N-ethylbenzamide |
| SMILES | C=CN(/N=C/C)c1cccc(C(=O)NCC)c1.CC |
| InChI | InChI=1S/C13H17N3O.C2H6/c1-4-14-13(17)11-8-7-9-12(10-11)16(6-3)15-5-2;1-2/h5-10H,3-4H2,1-2H3,(H,14,17);1-2H3/b15-5+; |
| InChIKey | SAAZMGFPCBBZTD-GBDQXREISA-N |
| XLogP | 3.42 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-[ethenyl-[(E)-ethylideneamino]amino]-N-ethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-[ethenyl-[(E)-ethylideneamino]amino]-N-ethylbenzamide?
The IUPAC name of ethane;3-[ethenyl-[(E)-ethylideneamino]amino]-N-ethylbenzamide (CID 142945288) is ethane;3-[ethenyl-[(E)-ethylideneamino]amino]-N-ethylbenzamide.
What is the SMILES notation for ethane;3-[ethenyl-[(E)-ethylideneamino]amino]-N-ethylbenzamide?
The canonical SMILES for ethane;3-[ethenyl-[(E)-ethylideneamino]amino]-N-ethylbenzamide is C=CN(/N=C/C)c1cccc(C(=O)NCC)c1.CC.
What is the InChIKey of ethane;3-[ethenyl-[(E)-ethylideneamino]amino]-N-ethylbenzamide?
The InChIKey is SAAZMGFPCBBZTD-GBDQXREISA-N. The full InChI is InChI=1S/C13H17N3O.C2H6/c1-4-14-13(17)11-8-7-9-12(10-11)16(6-3)15-5-2;1-2/h5-10H,3-4H2,1-2H3,(H,14,17);1-2H3/b15-5+;.
What are the key properties of ethane;3-[ethenyl-[(E)-ethylideneamino]amino]-N-ethylbenzamide?
ethane;3-[ethenyl-[(E)-ethylideneamino]amino]-N-ethylbenzamide has a molecular weight of 261.37 g/mol, XLogP of 3.42, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-[ethenyl-[(E)-ethylideneamino]amino]-N-ethylbenzamide is sourced from PubChem (CID 142945288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).