C39H38N2S2 — CID 170187699
3-(10-tert-butylphenothiazin-3-yl)-7-(2,2-dimethylpropyl)-10-phenylphenothiazine (PubChem CID 170187699) has the molecular formula C39H38N2S2 and a molecular weight of 598.88 g/mol. Its IUPAC name is 3-(10-tert-butylphenothiazin-3-yl)-7-(2,2-dimethylpropyl)-10-phenylphenothiazine.
| Compound Name | 3-(10-tert-butylphenothiazin-3-yl)-7-(2,2-dimethylpropyl)-10-phenylphenothiazine |
|---|---|
| PubChem CID | 170187699 |
| Molecular Formula | C39H38N2S2 |
| Molecular Weight | 598.88 g/mol |
| Exact Mass | 598.25 |
| IUPAC Name | 3-(10-tert-butylphenothiazin-3-yl)-7-(2,2-dimethylpropyl)-10-phenylphenothiazine |
| SMILES | CC(C)(C)Cc1ccc2c(c1)Sc1cc(-c3ccc4c(c3)Sc3ccccc3N4C(C)(C)C)ccc1N2c1ccccc1 |
| InChI | InChI=1S/C39H38N2S2/c1-38(2,3)25-26-16-19-30-35(22-26)43-36-23-27(17-20-31(36)40(30)29-12-8-7-9-13-29)28-18-21-33-37(24-28)42-34-15-11-10-14-32(34)41(33)39(4,5)6/h7-24H,25H2,1-6H3 |
| InChIKey | CFJNAQHQQIFEPI-UHFFFAOYSA-N |
| XLogP | 12.28 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.88 |
| LogP ≤ 5 | 12.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |