C19H21IN2O4 — CID 17018818
2-(2,4-dimethylphenoxy)-N-[(Z)-(3-iodo-4,5-dimethoxyphenyl)methylideneamino]acetamide (PubChem CID 17018818) has the molecular formula C19H21IN2O4 and a molecular weight of 468.29 g/mol. Its IUPAC name is 2-(2,4-dimethylphenoxy)-N-[(Z)-(3-iodo-4,5-dimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2,4-dimethylphenoxy)-N-[(Z)-(3-iodo-4,5-dimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 17018818 |
| Molecular Formula | C19H21IN2O4 |
| Molecular Weight | 468.29 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | 2-(2,4-dimethylphenoxy)-N-[(Z)-(3-iodo-4,5-dimethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cc(/C=N\NC(=O)COc2ccc(C)cc2C)cc(I)c1OC |
| InChI | InChI=1S/C19H21IN2O4/c1-12-5-6-16(13(2)7-12)26-11-18(23)22-21-10-14-8-15(20)19(25-4)17(9-14)24-3/h5-10H,11H2,1-4H3,(H,22,23)/b21-10- |
| InChIKey | MQCRKPMBDBNXNL-FBHDLOMBSA-N |
| XLogP | 3.45 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|