C27H28N2O7 — CID 41329859
[2-[(E)-[[2-(2,4-dimethylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3,4,5-trimethoxybenzoate (PubChem CID 41329859) has the molecular formula C27H28N2O7 and a molecular weight of 492.53 g/mol. Its IUPAC name is [2-[(E)-[[2-(2,4-dimethylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [2-[(E)-[[2-(2,4-dimethylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 41329859 |
| Molecular Formula | C27H28N2O7 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | [2-[(E)-[[2-(2,4-dimethylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2ccccc2/C=N/NC(=O)COc2ccc(C)cc2C)cc(OC)c1OC |
| InChI | InChI=1S/C27H28N2O7/c1-17-10-11-21(18(2)12-17)35-16-25(30)29-28-15-19-8-6-7-9-22(19)36-27(31)20-13-23(32-3)26(34-5)24(14-20)33-4/h6-15H,16H2,1-5H3,(H,29,30)/b28-15+ |
| InChIKey | YZYJMIGAFGHECE-RWPZCVJISA-N |
| XLogP | 4.08 |
| TPSA | 104.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|