C18H18N2O4 — CID 19190263
2-[(E)-[[2-(2,4-dimethylphenoxy)acetyl]hydrazinylidene]methyl]benzoic acid (PubChem CID 19190263) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 2-[(E)-[[2-(2,4-dimethylphenoxy)acetyl]hydrazinylidene]methyl]benzoic acid.
| Compound Name | 2-[(E)-[[2-(2,4-dimethylphenoxy)acetyl]hydrazinylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 19190263 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-[(E)-[[2-(2,4-dimethylphenoxy)acetyl]hydrazinylidene]methyl]benzoic acid |
| SMILES | Cc1ccc(OCC(=O)N/N=C/c2ccccc2C(=O)O)c(C)c1 |
| InChI | InChI=1S/C18H18N2O4/c1-12-7-8-16(13(2)9-12)24-11-17(21)20-19-10-14-5-3-4-6-15(14)18(22)23/h3-10H,11H2,1-2H3,(H,20,21)(H,22,23)/b19-10+ |
| InChIKey | ISZVUCYYNIOZRE-VXLYETTFSA-N |
| XLogP | 2.53 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|