C47H31N3O15 — CID 170188976
3-(2,3,4,5,6-pentahydroxyphenyl)-7-[4-(4-phenylphenyl)-6-(5,6,7,8-tetrahydroxy-9H-fluoren-1-yl)-1,3,5-triazin-2-yl]-9H-fluorene-1,2,4,5,6,8-hexol (PubChem CID 170188976) has the molecular formula C47H31N3O15 and a molecular weight of 877.77 g/mol. Its IUPAC name is 3-(2,3,4,5,6-pentahydroxyphenyl)-7-[4-(4-phenylphenyl)-6-(5,6,7,8-tetrahydroxy-9H-fluoren-1-yl)-1,3,5-triazin-2-yl]-9H-fluorene-1,2,4,5,6,8-hexol.
| Compound Name | 3-(2,3,4,5,6-pentahydroxyphenyl)-7-[4-(4-phenylphenyl)-6-(5,6,7,8-tetrahydroxy-9H-fluoren-1-yl)-1,3,5-triazin-2-yl]-9H-fluorene-1,2,4,5,6,8-hexol |
|---|---|
| PubChem CID | 170188976 |
| Molecular Formula | C47H31N3O15 |
| Molecular Weight | 877.77 g/mol |
| Exact Mass | 877.18 |
| IUPAC Name | 3-(2,3,4,5,6-pentahydroxyphenyl)-7-[4-(4-phenylphenyl)-6-(5,6,7,8-tetrahydroxy-9H-fluoren-1-yl)-1,3,5-triazin-2-yl]-9H-fluorene-1,2,4,5,6,8-hexol |
| SMILES | Oc1c(O)c(O)c(-c2c(O)c(O)c3c(c2O)-c2c(O)c(O)c(-c4nc(-c5ccc(-c6ccccc6)cc5)nc(-c5cccc6c5Cc5c(O)c(O)c(O)c(O)c5-6)n4)c(O)c2C3)c(O)c1O |
| InChI | InChI=1S/C47H31N3O15/c51-30-22-14-23-25(33(54)27(36(57)31(23)52)28-37(58)42(63)44(65)43(64)38(28)59)26(22)35(56)39(60)29(30)47-49-45(17-11-9-16(10-12-17)15-5-2-1-3-6-15)48-46(50-47)19-8-4-7-18-20(19)13-21-24(18)34(55)41(62)40(61)32(21)53/h1-12,51-65H,13-14H2 |
| InChIKey | ZHXPDOWPQZDWAW-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 342.12 Ų |
| H-Bond Donors | 15 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 65 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.77 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 15 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|