C47H33N3 — CID 134509781
2-[4-[8-[4-(4-methylphenyl)phenyl]-9H-fluoren-1-yl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 134509781) has the molecular formula C47H33N3 and a molecular weight of 639.80 g/mol. Its IUPAC name is 2-[4-[8-[4-(4-methylphenyl)phenyl]-9H-fluoren-1-yl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[4-[8-[4-(4-methylphenyl)phenyl]-9H-fluoren-1-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 134509781 |
| Molecular Formula | C47H33N3 |
| Molecular Weight | 639.80 g/mol |
| Exact Mass | 639.27 |
| IUPAC Name | 2-[4-[8-[4-(4-methylphenyl)phenyl]-9H-fluoren-1-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | Cc1ccc(-c2ccc(-c3cccc4c3Cc3c(-c5ccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)cc5)cccc3-4)cc2)cc1 |
| InChI | InChI=1S/C47H33N3/c1-31-18-20-32(21-19-31)33-22-24-34(25-23-33)39-14-8-16-41-42-17-9-15-40(44(42)30-43(39)41)35-26-28-38(29-27-35)47-49-45(36-10-4-2-5-11-36)48-46(50-47)37-12-6-3-7-13-37/h2-29H,30H2,1H3 |
| InChIKey | MJRCVGXPTYVPTB-UHFFFAOYSA-N |
| XLogP | 11.75 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.80 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |