C35H37BrN8O5 — CID 170189241
(13Z)-22-[2-[3-acetyl-5-(2-methylpyrimidin-5-yl)indazol-1-yl]acetyl]-6-bromo-20-methyl-11-oxa-3,5,18,22-tetrazatricyclo[18.2.1.04,9]tricosa-4(9),5,7,13-tetraene-2,17-dione (PubChem CID 170189241) has the molecular formula C35H37BrN8O5 and a molecular weight of 729.64 g/mol. Its IUPAC name is (13Z)-22-[2-[3-acetyl-5-(2-methylpyrimidin-5-yl)indazol-1-yl]acetyl]-6-bromo-20-methyl-11-oxa-3,5,18,22-tetrazatricyclo[18.2.1.04,9]tricosa-4(9),5,7,13-tetraene-2,17-dione.
| Compound Name | (13Z)-22-[2-[3-acetyl-5-(2-methylpyrimidin-5-yl)indazol-1-yl]acetyl]-6-bromo-20-methyl-11-oxa-3,5,18,22-tetrazatricyclo[18.2.1.04,9]tricosa-4(9),5,7,13-tetraene-2,17-dione |
|---|---|
| PubChem CID | 170189241 |
| Molecular Formula | C35H37BrN8O5 |
| Molecular Weight | 729.64 g/mol |
| Exact Mass | 728.21 |
| IUPAC Name | (13Z)-22-[2-[3-acetyl-5-(2-methylpyrimidin-5-yl)indazol-1-yl]acetyl]-6-bromo-20-methyl-11-oxa-3,5,18,22-tetrazatricyclo[18.2.1.04,9]tricosa-4(9),5,7,13-tetraene-2,17-dione |
| SMILES | CC(=O)c1nn(CC(=O)N2CC3(C)CNC(=O)CC/C=C\COCc4ccc(Br)nc4NC(=O)C2C3)c2ccc(-c3cnc(C)nc3)cc12 |
| InChI | InChI=1S/C35H37BrN8O5/c1-21(45)32-26-13-23(25-15-37-22(2)38-16-25)8-10-27(26)44(42-32)17-31(47)43-20-35(3)14-28(43)34(48)41-33-24(9-11-29(36)40-33)18-49-12-6-4-5-7-30(46)39-19-35/h4,6,8-11,13,15-16,28H,5,7,12,14,17-20H2,1-3H3,(H,39,46)(H,40,41,48)/b6-4- |
| InChIKey | QOEWFOJLLJRNAI-XQRVVYSFSA-N |
| XLogP | 4.39 |
| TPSA | 161.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.64 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|