C32H33BrIN7O5 — CID 174097878
(1S,19R)-20-[2-[3-acetyl-5-(2-methylpyrimidin-5-yl)indazol-1-yl]acetyl]-6-bromo-19-iodo-11,16-dioxa-3,5,20-triazatricyclo[16.2.1.04,9]henicosa-4(9),5,7-trien-2-one (PubChem CID 174097878) has the molecular formula C32H33BrIN7O5 and a molecular weight of 802.47 g/mol. Its IUPAC name is (1S,19R)-20-[2-[3-acetyl-5-(2-methylpyrimidin-5-yl)indazol-1-yl]acetyl]-6-bromo-19-iodo-11,16-dioxa-3,5,20-triazatricyclo[16.2.1.04,9]henicosa-4(9),5,7-trien-2-one.
| Compound Name | (1S,19R)-20-[2-[3-acetyl-5-(2-methylpyrimidin-5-yl)indazol-1-yl]acetyl]-6-bromo-19-iodo-11,16-dioxa-3,5,20-triazatricyclo[16.2.1.04,9]henicosa-4(9),5,7-trien-2-one |
|---|---|
| PubChem CID | 174097878 |
| Molecular Formula | C32H33BrIN7O5 |
| Molecular Weight | 802.47 g/mol |
| Exact Mass | 801.08 |
| IUPAC Name | (1S,19R)-20-[2-[3-acetyl-5-(2-methylpyrimidin-5-yl)indazol-1-yl]acetyl]-6-bromo-19-iodo-11,16-dioxa-3,5,20-triazatricyclo[16.2.1.04,9]henicosa-4(9),5,7-trien-2-one |
| SMILES | CC(=O)c1nn(CC(=O)N2[C@H](I)C3COCCCCOCc4ccc(Br)nc4NC(=O)[C@@H]2C3)c2ccc(-c3cnc(C)nc3)cc12 |
| InChI | InChI=1S/C32H33BrIN7O5/c1-18(42)29-24-11-20(23-13-35-19(2)36-14-23)5-7-25(24)40(39-29)15-28(43)41-26-12-22(30(41)34)17-46-10-4-3-9-45-16-21-6-8-27(33)37-31(21)38-32(26)44/h5-8,11,13-14,22,26,30H,3-4,9-10,12,15-17H2,1-2H3,(H,37,38,44)/t22?,26-,30-/m0/s1 |
| InChIKey | SDXWUCALVDTXGV-RWMHTRQUSA-N |
| XLogP | 5.11 |
| TPSA | 141.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|