C12H17NO — CID 170191308
N,4,4-trimethyl-2,3-dihydrochromen-8-amine (PubChem CID 170191308) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is N,4,4-trimethyl-2,3-dihydrochromen-8-amine.
| Compound Name | N,4,4-trimethyl-2,3-dihydrochromen-8-amine |
|---|---|
| PubChem CID | 170191308 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | N,4,4-trimethyl-2,3-dihydrochromen-8-amine |
| SMILES | CNc1cccc2c1OCCC2(C)C |
| InChI | InChI=1S/C12H17NO/c1-12(2)7-8-14-11-9(12)5-4-6-10(11)13-3/h4-6,13H,7-8H2,1-3H3 |
| InChIKey | GJAMMYUOQVKVPO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |