About 4-(difluoromethyl)-2-(1-methylpyrazol-4-yl)-1,3-oxazole-5-thiol
4-(difluoromethyl)-2-(1-methylpyrazol-4-yl)-1,3-oxazole-5-thiol (PubChem CID 170193150) has the molecular formula C8H7F2N3OS
and a molecular weight of 231.23 g/mol. Its IUPAC name is 4-(difluoromethyl)-2-(1-methylpyrazol-4-yl)-1,3-oxazole-5-thiol.
Molecular Properties
| Compound Name | 4-(difluoromethyl)-2-(1-methylpyrazol-4-yl)-1,3-oxazole-5-thiol |
| PubChem CID | 170193150 |
| Molecular Formula | C8H7F2N3OS |
| Molecular Weight | 231.23 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 4-(difluoromethyl)-2-(1-methylpyrazol-4-yl)-1,3-oxazole-5-thiol |
| SMILES | Cn1cc(-c2nc(C(F)F)c(S)o2)cn1 |
| InChI | InChI=1S/C8H7F2N3OS/c1-13-3-4(2-11-13)7-12-5(6(9)10)8(15)14-7/h2-3,6,15H,1H3 |
| InChIKey | LGXSLBGJKLEJLM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 43.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(difluoromethyl)-2-(1-methylpyrazol-4-yl)-1,3-oxazole-5-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(difluoromethyl)-2-(1-methylpyrazol-4-yl)-1,3-oxazole-5-thiol?
The IUPAC name of 4-(difluoromethyl)-2-(1-methylpyrazol-4-yl)-1,3-oxazole-5-thiol (CID 170193150) is 4-(difluoromethyl)-2-(1-methylpyrazol-4-yl)-1,3-oxazole-5-thiol.
What is the SMILES notation for 4-(difluoromethyl)-2-(1-methylpyrazol-4-yl)-1,3-oxazole-5-thiol?
The canonical SMILES for 4-(difluoromethyl)-2-(1-methylpyrazol-4-yl)-1,3-oxazole-5-thiol is Cn1cc(-c2nc(C(F)F)c(S)o2)cn1.
What is the InChIKey of 4-(difluoromethyl)-2-(1-methylpyrazol-4-yl)-1,3-oxazole-5-thiol?
The InChIKey is LGXSLBGJKLEJLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F2N3OS/c1-13-3-4(2-11-13)7-12-5(6(9)10)8(15)14-7/h2-3,6,15H,1H3.
What are the key properties of 4-(difluoromethyl)-2-(1-methylpyrazol-4-yl)-1,3-oxazole-5-thiol?
4-(difluoromethyl)-2-(1-methylpyrazol-4-yl)-1,3-oxazole-5-thiol has a molecular weight of 231.23 g/mol, XLogP of 2.30, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(difluoromethyl)-2-(1-methylpyrazol-4-yl)-1,3-oxazole-5-thiol is sourced from PubChem (CID 170193150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).