C8H7F2N3OS — CID 170193150
4-(difluoromethyl)-2-(1-methylpyrazol-4-yl)-1,3-oxazole-5-thiol (PubChem CID 170193150) has the molecular formula C8H7F2N3OS and a molecular weight of 231.23 g/mol. Its IUPAC name is 4-(difluoromethyl)-2-(1-methylpyrazol-4-yl)-1,3-oxazole-5-thiol.
| Compound Name | 4-(difluoromethyl)-2-(1-methylpyrazol-4-yl)-1,3-oxazole-5-thiol |
|---|---|
| PubChem CID | 170193150 |
| Molecular Formula | C8H7F2N3OS |
| Molecular Weight | 231.23 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 4-(difluoromethyl)-2-(1-methylpyrazol-4-yl)-1,3-oxazole-5-thiol |
| SMILES | Cn1cc(-c2nc(C(F)F)c(S)o2)cn1 |
| InChI | InChI=1S/C8H7F2N3OS/c1-13-3-4(2-11-13)7-12-5(6(9)10)8(15)14-7/h2-3,6,15H,1H3 |
| InChIKey | LGXSLBGJKLEJLM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 43.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|