C7H6N4O2 — CID 175961593
5-(1-methylpyrazol-4-yl)-1,3,4-oxadiazole-2-carbaldehyde (PubChem CID 175961593) has the molecular formula C7H6N4O2 and a molecular weight of 178.15 g/mol. Its IUPAC name is 5-(1-methylpyrazol-4-yl)-1,3,4-oxadiazole-2-carbaldehyde.
| Compound Name | 5-(1-methylpyrazol-4-yl)-1,3,4-oxadiazole-2-carbaldehyde |
|---|---|
| PubChem CID | 175961593 |
| Molecular Formula | C7H6N4O2 |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | 5-(1-methylpyrazol-4-yl)-1,3,4-oxadiazole-2-carbaldehyde |
| SMILES | Cn1cc(-c2nnc(C=O)o2)cn1 |
| InChI | InChI=1S/C7H6N4O2/c1-11-3-5(2-8-11)7-10-9-6(4-12)13-7/h2-4H,1H3 |
| InChIKey | OVFPVIATOHXKQZ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|