C7H12FN — CID 170194734
8-fluoro-1,2,3,5,6,7-hexahydropyrrolizine (PubChem CID 170194734) has the molecular formula C7H12FN and a molecular weight of 129.18 g/mol. Its IUPAC name is 8-fluoro-1,2,3,5,6,7-hexahydropyrrolizine.
| Compound Name | 8-fluoro-1,2,3,5,6,7-hexahydropyrrolizine |
|---|---|
| PubChem CID | 170194734 |
| Molecular Formula | C7H12FN |
| Molecular Weight | 129.18 g/mol |
| Exact Mass | 129.10 |
| IUPAC Name | 8-fluoro-1,2,3,5,6,7-hexahydropyrrolizine |
| SMILES | FC12CCCN1CCC2 |
| InChI | InChI=1S/C7H12FN/c8-7-3-1-5-9(7)6-2-4-7/h1-6H2 |
| InChIKey | DUIPYPJTCUVTEG-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.18 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|