About tridecan-7-yl 6-(3-methoxy-2-methylpropanoyl)oxyhexanoate
tridecan-7-yl 6-(3-methoxy-2-methylpropanoyl)oxyhexanoate (PubChem CID 170201243) has the molecular formula C24H46O5
and a molecular weight of 414.63 g/mol. Its IUPAC name is tridecan-7-yl 6-(3-methoxy-2-methylpropanoyl)oxyhexanoate.
Molecular Properties
| Compound Name | tridecan-7-yl 6-(3-methoxy-2-methylpropanoyl)oxyhexanoate |
| PubChem CID | 170201243 |
| Molecular Formula | C24H46O5 |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 414.33 |
| IUPAC Name | tridecan-7-yl 6-(3-methoxy-2-methylpropanoyl)oxyhexanoate |
| SMILES | CCCCCCC(CCCCCC)OC(=O)CCCCCOC(=O)C(C)COC |
| InChI | InChI=1S/C24H46O5/c1-5-7-9-12-16-22(17-13-10-8-6-2)29-23(25)18-14-11-15-19-28-24(26)21(3)20-27-4/h21-22H,5-20H2,1-4H3 |
| InChIKey | MGMFEISMUMNYTC-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tridecan-7-yl 6-(3-methoxy-2-methylpropanoyl)oxyhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tridecan-7-yl 6-(3-methoxy-2-methylpropanoyl)oxyhexanoate?
The IUPAC name of tridecan-7-yl 6-(3-methoxy-2-methylpropanoyl)oxyhexanoate (CID 170201243) is tridecan-7-yl 6-(3-methoxy-2-methylpropanoyl)oxyhexanoate.
What is the SMILES notation for tridecan-7-yl 6-(3-methoxy-2-methylpropanoyl)oxyhexanoate?
The canonical SMILES for tridecan-7-yl 6-(3-methoxy-2-methylpropanoyl)oxyhexanoate is CCCCCCC(CCCCCC)OC(=O)CCCCCOC(=O)C(C)COC.
What is the InChIKey of tridecan-7-yl 6-(3-methoxy-2-methylpropanoyl)oxyhexanoate?
The InChIKey is MGMFEISMUMNYTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H46O5/c1-5-7-9-12-16-22(17-13-10-8-6-2)29-23(25)18-14-11-15-19-28-24(26)21(3)20-27-4/h21-22H,5-20H2,1-4H3.
What are the key properties of tridecan-7-yl 6-(3-methoxy-2-methylpropanoyl)oxyhexanoate?
tridecan-7-yl 6-(3-methoxy-2-methylpropanoyl)oxyhexanoate has a molecular weight of 414.63 g/mol, XLogP of 6.23, 20 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tridecan-7-yl 6-(3-methoxy-2-methylpropanoyl)oxyhexanoate is sourced from PubChem (CID 170201243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).