C9H8N4S — CID 170201826
5-(1-benzothiophen-3-yl)-2,3-dihydro-1H-tetrazole (PubChem CID 170201826) has the molecular formula C9H8N4S and a molecular weight of 204.26 g/mol. Its IUPAC name is 5-(1-benzothiophen-3-yl)-2,3-dihydro-1H-tetrazole.
| Compound Name | 5-(1-benzothiophen-3-yl)-2,3-dihydro-1H-tetrazole |
|---|---|
| PubChem CID | 170201826 |
| Molecular Formula | C9H8N4S |
| Molecular Weight | 204.26 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 5-(1-benzothiophen-3-yl)-2,3-dihydro-1H-tetrazole |
| SMILES | c1ccc2c(C3=NNNN3)csc2c1 |
| InChI | InChI=1S/C9H8N4S/c1-2-4-8-6(3-1)7(5-14-8)9-10-12-13-11-9/h1-5,12-13H,(H,10,11) |
| InChIKey | VBZRGPZZXXNHJO-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |