C22H16Cl2N4O3 — CID 170204505
4,6-dichloro-5-hydroxy-N-[3-[(3-methylphenyl)methyl]-4-oxoquinazolin-5-yl]pyridine-2-carboxamide (PubChem CID 170204505) has the molecular formula C22H16Cl2N4O3 and a molecular weight of 455.30 g/mol. Its IUPAC name is 4,6-dichloro-5-hydroxy-N-[3-[(3-methylphenyl)methyl]-4-oxoquinazolin-5-yl]pyridine-2-carboxamide.
| Compound Name | 4,6-dichloro-5-hydroxy-N-[3-[(3-methylphenyl)methyl]-4-oxoquinazolin-5-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 170204505 |
| Molecular Formula | C22H16Cl2N4O3 |
| Molecular Weight | 455.30 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | 4,6-dichloro-5-hydroxy-N-[3-[(3-methylphenyl)methyl]-4-oxoquinazolin-5-yl]pyridine-2-carboxamide |
| SMILES | Cc1cccc(Cn2cnc3cccc(NC(=O)c4cc(Cl)c(O)c(Cl)n4)c3c2=O)c1 |
| InChI | InChI=1S/C22H16Cl2N4O3/c1-12-4-2-5-13(8-12)10-28-11-25-15-6-3-7-16(18(15)22(28)31)27-21(30)17-9-14(23)19(29)20(24)26-17/h2-9,11,29H,10H2,1H3,(H,27,30) |
| InChIKey | ICTMVKZOAMJZBK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.30 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|