C26H22Cl2N4O5S — CID 167072074
3,5-dichloro-N-[3-[[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]methyl]-4-oxoquinazolin-5-yl]-4-hydroxybenzamide (PubChem CID 167072074) has the molecular formula C26H22Cl2N4O5S and a molecular weight of 573.46 g/mol. Its IUPAC name is 3,5-dichloro-N-[3-[[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]methyl]-4-oxoquinazolin-5-yl]-4-hydroxybenzamide.
| Compound Name | 3,5-dichloro-N-[3-[[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]methyl]-4-oxoquinazolin-5-yl]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 167072074 |
| Molecular Formula | C26H22Cl2N4O5S |
| Molecular Weight | 573.46 g/mol |
| Exact Mass | 572.07 |
| IUPAC Name | 3,5-dichloro-N-[3-[[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]methyl]-4-oxoquinazolin-5-yl]-4-hydroxybenzamide |
| SMILES | O=C(Nc1cccc2ncn(Cc3ccc(N4CCS(=O)(=O)CC4)cc3)c(=O)c12)c1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C26H22Cl2N4O5S/c27-19-12-17(13-20(28)24(19)33)25(34)30-22-3-1-2-21-23(22)26(35)32(15-29-21)14-16-4-6-18(7-5-16)31-8-10-38(36,37)11-9-31/h1-7,12-13,15,33H,8-11,14H2,(H,30,34) |
| InChIKey | DYOXKTWNBYHIQN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|