C17H13F3IN5O2 — CID 170204533
6-[2-(3,3-difluoro-3-iodopropoxy)pyrimidin-5-yl]-2-[(5-fluoro-3-pyridinyl)methyl]pyridazin-3-one (PubChem CID 170204533) has the molecular formula C17H13F3IN5O2 and a molecular weight of 503.22 g/mol. Its IUPAC name is 6-[2-(3,3-difluoro-3-iodopropoxy)pyrimidin-5-yl]-2-[(5-fluoro-3-pyridinyl)methyl]pyridazin-3-one.
| Compound Name | 6-[2-(3,3-difluoro-3-iodopropoxy)pyrimidin-5-yl]-2-[(5-fluoro-3-pyridinyl)methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 170204533 |
| Molecular Formula | C17H13F3IN5O2 |
| Molecular Weight | 503.22 g/mol |
| Exact Mass | 503.01 |
| IUPAC Name | 6-[2-(3,3-difluoro-3-iodopropoxy)pyrimidin-5-yl]-2-[(5-fluoro-3-pyridinyl)methyl]pyridazin-3-one |
| SMILES | O=c1ccc(-c2cnc(OCCC(F)(F)I)nc2)nn1Cc1cncc(F)c1 |
| InChI | InChI=1S/C17H13F3IN5O2/c18-13-5-11(6-22-9-13)10-26-15(27)2-1-14(25-26)12-7-23-16(24-8-12)28-4-3-17(19,20)21/h1-2,5-9H,3-4,10H2 |
| InChIKey | BLVBTXDFJZQTDN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 82.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.22 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|