C17H13F4N4O2P — CID 170316230
2-[(3,5-difluorophenyl)methyl]-6-[2-(2,2-difluoro-2-phosphanylethoxy)pyrimidin-5-yl]pyridazin-3-one (PubChem CID 170316230) has the molecular formula C17H13F4N4O2P and a molecular weight of 412.28 g/mol. Its IUPAC name is 2-[(3,5-difluorophenyl)methyl]-6-[2-(2,2-difluoro-2-phosphanylethoxy)pyrimidin-5-yl]pyridazin-3-one.
| Compound Name | 2-[(3,5-difluorophenyl)methyl]-6-[2-(2,2-difluoro-2-phosphanylethoxy)pyrimidin-5-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 170316230 |
| Molecular Formula | C17H13F4N4O2P |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 2-[(3,5-difluorophenyl)methyl]-6-[2-(2,2-difluoro-2-phosphanylethoxy)pyrimidin-5-yl]pyridazin-3-one |
| SMILES | O=c1ccc(-c2cnc(OCC(F)(F)P)nc2)nn1Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C17H13F4N4O2P/c18-12-3-10(4-13(19)5-12)8-25-15(26)2-1-14(24-25)11-6-22-16(23-7-11)27-9-17(20,21)28/h1-7H,8-9,28H2 |
| InChIKey | KYBODUNDPPEXQE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|