C16H17F3N4O2 — CID 174112849
2-[(Z)-3-methylpent-2-enyl]-6-[2-(2,2,2-trifluoroethoxy)pyrimidin-5-yl]pyridazin-3-one (PubChem CID 174112849) has the molecular formula C16H17F3N4O2 and a molecular weight of 354.33 g/mol. Its IUPAC name is 2-[(Z)-3-methylpent-2-enyl]-6-[2-(2,2,2-trifluoroethoxy)pyrimidin-5-yl]pyridazin-3-one.
| Compound Name | 2-[(Z)-3-methylpent-2-enyl]-6-[2-(2,2,2-trifluoroethoxy)pyrimidin-5-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 174112849 |
| Molecular Formula | C16H17F3N4O2 |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 2-[(Z)-3-methylpent-2-enyl]-6-[2-(2,2,2-trifluoroethoxy)pyrimidin-5-yl]pyridazin-3-one |
| SMILES | CC/C(C)=C\Cn1nc(-c2cnc(OCC(F)(F)F)nc2)ccc1=O |
| InChI | InChI=1S/C16H17F3N4O2/c1-3-11(2)6-7-23-14(24)5-4-13(22-23)12-8-20-15(21-9-12)25-10-16(17,18)19/h4-6,8-9H,3,7,10H2,1-2H3/b11-6- |
| InChIKey | HFSGSBLWIWYETG-WDZFZDKYSA-N |
| XLogP | 3.00 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|