C34H48N4O7S — CID 170206404
(4S,5R)-4-amino-5-[[4-[3-[2-[2-[2-[2-(formamidomethyl)-5-(4-methyl-1,3-thiazol-5-yl)phenoxy]ethoxy]ethoxy]ethoxy]propyl]phenyl]methoxy]hexanamide (PubChem CID 170206404) has the molecular formula C34H48N4O7S and a molecular weight of 656.85 g/mol. Its IUPAC name is (4S,5R)-4-amino-5-[[4-[3-[2-[2-[2-[2-(formamidomethyl)-5-(4-methyl-1,3-thiazol-5-yl)phenoxy]ethoxy]ethoxy]ethoxy]propyl]phenyl]methoxy]hexanamide.
| Compound Name | (4S,5R)-4-amino-5-[[4-[3-[2-[2-[2-[2-(formamidomethyl)-5-(4-methyl-1,3-thiazol-5-yl)phenoxy]ethoxy]ethoxy]ethoxy]propyl]phenyl]methoxy]hexanamide |
|---|---|
| PubChem CID | 170206404 |
| Molecular Formula | C34H48N4O7S |
| Molecular Weight | 656.85 g/mol |
| Exact Mass | 656.32 |
| IUPAC Name | (4S,5R)-4-amino-5-[[4-[3-[2-[2-[2-[2-(formamidomethyl)-5-(4-methyl-1,3-thiazol-5-yl)phenoxy]ethoxy]ethoxy]ethoxy]propyl]phenyl]methoxy]hexanamide |
| SMILES | Cc1ncsc1-c1ccc(CNC=O)c(OCCOCCOCCOCCCc2ccc(CO[C@H](C)[C@@H](N)CCC(N)=O)cc2)c1 |
| InChI | InChI=1S/C34H48N4O7S/c1-25-34(46-24-38-25)29-9-10-30(21-37-23-39)32(20-29)44-19-18-43-17-16-42-15-14-41-13-3-4-27-5-7-28(8-6-27)22-45-26(2)31(35)11-12-33(36)40/h5-10,20,23-24,26,31H,3-4,11-19,21-22,35H2,1-2H3,(H2,36,40)(H,37,39)/t26-,31+/m1/s1 |
| InChIKey | HIZNIGSWUSRRGC-NEEKEDPPSA-N |
| XLogP | 3.92 |
| TPSA | 157.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.85 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|