C33H44N4O5 — CID 170206949
(2S)-N-[(2R,3S)-6-amino-2-[[4-(7-amino-7-oxoheptyl)phenyl]methoxy]-6-oxohexan-3-yl]-12-oxo-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide (PubChem CID 170206949) has the molecular formula C33H44N4O5 and a molecular weight of 576.74 g/mol. Its IUPAC name is (2S)-N-[(2R,3S)-6-amino-2-[[4-(7-amino-7-oxoheptyl)phenyl]methoxy]-6-oxohexan-3-yl]-12-oxo-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide.
| Compound Name | (2S)-N-[(2R,3S)-6-amino-2-[[4-(7-amino-7-oxoheptyl)phenyl]methoxy]-6-oxohexan-3-yl]-12-oxo-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide |
|---|---|
| PubChem CID | 170206949 |
| Molecular Formula | C33H44N4O5 |
| Molecular Weight | 576.74 g/mol |
| Exact Mass | 576.33 |
| IUPAC Name | (2S)-N-[(2R,3S)-6-amino-2-[[4-(7-amino-7-oxoheptyl)phenyl]methoxy]-6-oxohexan-3-yl]-12-oxo-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide |
| SMILES | C[C@@H](OCc1ccc(CCCCCCC(N)=O)cc1)[C@H](CCC(N)=O)NC(=O)[C@@H]1Cc2cccc3c2N1C(=O)CCC3 |
| InChI | InChI=1S/C33H44N4O5/c1-22(42-21-24-16-14-23(15-17-24)8-4-2-3-5-12-29(34)38)27(18-19-30(35)39)36-33(41)28-20-26-11-6-9-25-10-7-13-31(40)37(28)32(25)26/h6,9,11,14-17,22,27-28H,2-5,7-8,10,12-13,18-21H2,1H3,(H2,34,38)(H2,35,39)(H,36,41)/t22-,27+,28+/m1/s1 |
| InChIKey | OYKFRHIQFOOMHK-WWEDSPNTSA-N |
| XLogP | 3.61 |
| TPSA | 144.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.74 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|