C25H40N2O6 — CID 155188553
7-[4-[[(2R,3S)-6-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexan-2-yl]oxymethyl]phenyl]heptanoic acid (PubChem CID 155188553) has the molecular formula C25H40N2O6 and a molecular weight of 464.60 g/mol. Its IUPAC name is 7-[4-[[(2R,3S)-6-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexan-2-yl]oxymethyl]phenyl]heptanoic acid.
| Compound Name | 7-[4-[[(2R,3S)-6-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexan-2-yl]oxymethyl]phenyl]heptanoic acid |
|---|---|
| PubChem CID | 155188553 |
| Molecular Formula | C25H40N2O6 |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | 7-[4-[[(2R,3S)-6-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexan-2-yl]oxymethyl]phenyl]heptanoic acid |
| SMILES | C[C@@H](OCc1ccc(CCCCCCC(=O)O)cc1)[C@H](CCC(N)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H40N2O6/c1-18(21(15-16-22(26)28)27-24(31)33-25(2,3)4)32-17-20-13-11-19(12-14-20)9-7-5-6-8-10-23(29)30/h11-14,18,21H,5-10,15-17H2,1-4H3,(H2,26,28)(H,27,31)(H,29,30)/t18-,21+/m1/s1 |
| InChIKey | VYDMNLPOVQMDGT-NQIIRXRSSA-N |
| XLogP | 4.33 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|