C29H49BrN2O8 — CID 155189412
tert-butyl N-[(2R,3S)-6-amino-2-[[4-[3-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]propyl]phenyl]methoxy]-6-oxohexan-3-yl]carbamate (PubChem CID 155189412) has the molecular formula C29H49BrN2O8 and a molecular weight of 633.62 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S)-6-amino-2-[[4-[3-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]propyl]phenyl]methoxy]-6-oxohexan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3S)-6-amino-2-[[4-[3-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]propyl]phenyl]methoxy]-6-oxohexan-3-yl]carbamate |
|---|---|
| PubChem CID | 155189412 |
| Molecular Formula | C29H49BrN2O8 |
| Molecular Weight | 633.62 g/mol |
| Exact Mass | 632.27 |
| IUPAC Name | tert-butyl N-[(2R,3S)-6-amino-2-[[4-[3-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]propyl]phenyl]methoxy]-6-oxohexan-3-yl]carbamate |
| SMILES | C[C@@H](OCc1ccc(CCCOCCOCCOCCOCCBr)cc1)[C@H](CCC(N)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H49BrN2O8/c1-23(26(11-12-27(31)33)32-28(34)40-29(2,3)4)39-22-25-9-7-24(8-10-25)6-5-14-35-16-18-37-20-21-38-19-17-36-15-13-30/h7-10,23,26H,5-6,11-22H2,1-4H3,(H2,31,33)(H,32,34)/t23-,26+/m1/s1 |
| InChIKey | OJHQODVMCLWDGT-BVAGGSTKSA-N |
| XLogP | 4.14 |
| TPSA | 127.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.62 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|