C18H27BrN2O4 — CID 155170324
tert-butyl N-[6-amino-2-[(4-bromophenyl)methoxy]-6-oxohexan-3-yl]carbamate (PubChem CID 155170324) has the molecular formula C18H27BrN2O4 and a molecular weight of 415.33 g/mol. Its IUPAC name is tert-butyl N-[6-amino-2-[(4-bromophenyl)methoxy]-6-oxohexan-3-yl]carbamate.
| Compound Name | tert-butyl N-[6-amino-2-[(4-bromophenyl)methoxy]-6-oxohexan-3-yl]carbamate |
|---|---|
| PubChem CID | 155170324 |
| Molecular Formula | C18H27BrN2O4 |
| Molecular Weight | 415.33 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | tert-butyl N-[6-amino-2-[(4-bromophenyl)methoxy]-6-oxohexan-3-yl]carbamate |
| SMILES | CC(OCc1ccc(Br)cc1)C(CCC(N)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H27BrN2O4/c1-12(24-11-13-5-7-14(19)8-6-13)15(9-10-16(20)22)21-17(23)25-18(2,3)4/h5-8,12,15H,9-11H2,1-4H3,(H2,20,22)(H,21,23) |
| InChIKey | JAGFLNAQVAJUFS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |