C23H36N2O6 — CID 155189661
5-[3-[[(2R,3S)-6-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexan-2-yl]oxymethyl]phenyl]pentanoic acid (PubChem CID 155189661) has the molecular formula C23H36N2O6 and a molecular weight of 436.55 g/mol. Its IUPAC name is 5-[3-[[(2R,3S)-6-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexan-2-yl]oxymethyl]phenyl]pentanoic acid.
| Compound Name | 5-[3-[[(2R,3S)-6-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexan-2-yl]oxymethyl]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 155189661 |
| Molecular Formula | C23H36N2O6 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | 5-[3-[[(2R,3S)-6-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexan-2-yl]oxymethyl]phenyl]pentanoic acid |
| SMILES | C[C@@H](OCc1cccc(CCCCC(=O)O)c1)[C@H](CCC(N)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H36N2O6/c1-16(19(12-13-20(24)26)25-22(29)31-23(2,3)4)30-15-18-10-7-9-17(14-18)8-5-6-11-21(27)28/h7,9-10,14,16,19H,5-6,8,11-13,15H2,1-4H3,(H2,24,26)(H,25,29)(H,27,28)/t16-,19+/m1/s1 |
| InChIKey | OCXQFQPRCMXVLC-APWZRJJASA-N |
| XLogP | 3.55 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|