C24H36N2O6 — CID 155170174
(E)-6-[4-[[(2R,3S)-6-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexan-2-yl]oxymethyl]phenyl]hex-5-enoic acid (PubChem CID 155170174) has the molecular formula C24H36N2O6 and a molecular weight of 448.56 g/mol. Its IUPAC name is (E)-6-[4-[[(2R,3S)-6-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexan-2-yl]oxymethyl]phenyl]hex-5-enoic acid.
| Compound Name | (E)-6-[4-[[(2R,3S)-6-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexan-2-yl]oxymethyl]phenyl]hex-5-enoic acid |
|---|---|
| PubChem CID | 155170174 |
| Molecular Formula | C24H36N2O6 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | (E)-6-[4-[[(2R,3S)-6-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexan-2-yl]oxymethyl]phenyl]hex-5-enoic acid |
| SMILES | C[C@@H](OCc1ccc(/C=C/CCCC(=O)O)cc1)[C@H](CCC(N)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H36N2O6/c1-17(20(14-15-21(25)27)26-23(30)32-24(2,3)4)31-16-19-12-10-18(11-13-19)8-6-5-7-9-22(28)29/h6,8,10-13,17,20H,5,7,9,14-16H2,1-4H3,(H2,25,27)(H,26,30)(H,28,29)/b8-6+/t17-,20+/m1/s1 |
| InChIKey | UDDOYKLHHTVCJX-YSKVMHACSA-N |
| XLogP | 4.02 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|