C24H39N3O6 — CID 155189480
tert-butyl N-[(2R,3S)-6-amino-2-[[4-[4-(2-amino-2-oxoethoxy)butyl]phenyl]methoxy]-6-oxohexan-3-yl]carbamate (PubChem CID 155189480) has the molecular formula C24H39N3O6 and a molecular weight of 465.59 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S)-6-amino-2-[[4-[4-(2-amino-2-oxoethoxy)butyl]phenyl]methoxy]-6-oxohexan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3S)-6-amino-2-[[4-[4-(2-amino-2-oxoethoxy)butyl]phenyl]methoxy]-6-oxohexan-3-yl]carbamate |
|---|---|
| PubChem CID | 155189480 |
| Molecular Formula | C24H39N3O6 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.28 |
| IUPAC Name | tert-butyl N-[(2R,3S)-6-amino-2-[[4-[4-(2-amino-2-oxoethoxy)butyl]phenyl]methoxy]-6-oxohexan-3-yl]carbamate |
| SMILES | C[C@@H](OCc1ccc(CCCCOCC(N)=O)cc1)[C@H](CCC(N)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H39N3O6/c1-17(20(12-13-21(25)28)27-23(30)33-24(2,3)4)32-15-19-10-8-18(9-11-19)7-5-6-14-31-16-22(26)29/h8-11,17,20H,5-7,12-16H2,1-4H3,(H2,25,28)(H2,26,29)(H,27,30)/t17-,20+/m1/s1 |
| InChIKey | UMTUYXWGEVAKSS-XLIONFOSSA-N |
| XLogP | 2.58 |
| TPSA | 142.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|